C13H16F3N3 — CID 115303038
2-[[2-methyl-3-(methylamino)propyl]amino]-5-(trifluoromethyl)benzonitrile (PubChem CID 115303038) has the molecular formula C13H16F3N3 and a molecular weight of 271.29 g/mol. Its IUPAC name is 2-[[2-methyl-3-(methylamino)propyl]amino]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[[2-methyl-3-(methylamino)propyl]amino]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 115303038 |
| Molecular Formula | C13H16F3N3 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2-[[2-methyl-3-(methylamino)propyl]amino]-5-(trifluoromethyl)benzonitrile |
| SMILES | CNCC(C)CNc1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C13H16F3N3/c1-9(7-18-2)8-19-12-4-3-11(13(14,15)16)5-10(12)6-17/h3-5,9,18-19H,7-8H2,1-2H3 |
| InChIKey | QMDXTRUHSIVLNO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |