C15H21BrF3N — CID 107816448
2-bromo-N-(2-ethylhexyl)-4-(trifluoromethyl)aniline (PubChem CID 107816448) has the molecular formula C15H21BrF3N and a molecular weight of 352.24 g/mol. Its IUPAC name is 2-bromo-N-(2-ethylhexyl)-4-(trifluoromethyl)aniline.
| Compound Name | 2-bromo-N-(2-ethylhexyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 107816448 |
| Molecular Formula | C15H21BrF3N |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-bromo-N-(2-ethylhexyl)-4-(trifluoromethyl)aniline |
| SMILES | CCCCC(CC)CNc1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C15H21BrF3N/c1-3-5-6-11(4-2)10-20-14-8-7-12(9-13(14)16)15(17,18)19/h7-9,11,20H,3-6,10H2,1-2H3 |
| InChIKey | QJBUUPIFMBJKMR-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |