C11H8ClF3O4 — CID 170895454
2-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]propanedioic acid (PubChem CID 170895454) has the molecular formula C11H8ClF3O4 and a molecular weight of 296.63 g/mol. Its IUPAC name is 2-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]propanedioic acid.
| Compound Name | 2-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 170895454 |
| Molecular Formula | C11H8ClF3O4 |
| Molecular Weight | 296.63 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 2-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]propanedioic acid |
| SMILES | O=C(O)C(Cc1cc(C(F)(F)F)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H8ClF3O4/c12-8-2-1-6(11(13,14)15)3-5(8)4-7(9(16)17)10(18)19/h1-3,7H,4H2,(H,16,17)(H,18,19) |
| InChIKey | GXHMGWPMYNEHKK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.63 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|