C10H7Cl2F3O2 — CID 2781729
2-chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 2781729) has the molecular formula C10H7Cl2F3O2 and a molecular weight of 287.06 g/mol. Its IUPAC name is 2-chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 2-chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 2781729 |
| Molecular Formula | C10H7Cl2F3O2 |
| Molecular Weight | 287.06 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 2-chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | O=C(O)C(Cl)Cc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H7Cl2F3O2/c11-7-4-6(10(13,14)15)2-1-5(7)3-8(12)9(16)17/h1-2,4,8H,3H2,(H,16,17) |
| InChIKey | VHOLGURUOOMPRW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.06 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|