C10H6Cl2F3O2- — CID 6933471
(2R)-2-chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoate (PubChem CID 6933471) has the molecular formula C10H6Cl2F3O2- and a molecular weight of 286.06 g/mol. Its IUPAC name is (2R)-2-chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | (2R)-2-chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 6933471 |
| Molecular Formula | C10H6Cl2F3O2- |
| Molecular Weight | 286.06 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | (2R)-2-chloro-3-[2-chloro-4-(trifluoromethyl)phenyl]propanoate |
| SMILES | O=C([O-])[C@H](Cl)Cc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H7Cl2F3O2/c11-7-4-6(10(13,14)15)2-1-5(7)3-8(12)9(16)17/h1-2,4,8H,3H2,(H,16,17)/p-1/t8-/m1/s1 |
| InChIKey | VHOLGURUOOMPRW-MRVPVSSYSA-M |
| XLogP | 2.26 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.06 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|