C10H6Cl3F3O2 — CID 170873830
2-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 170873830) has the molecular formula C10H6Cl3F3O2 and a molecular weight of 321.51 g/mol. Its IUPAC name is 2-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 2-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 170873830 |
| Molecular Formula | C10H6Cl3F3O2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 319.94 |
| IUPAC Name | 2-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | O=C(O)C(Cl)Cc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H6Cl3F3O2/c11-6-1-4(10(14,15)16)2-7(12)5(6)3-8(13)9(17)18/h1-2,8H,3H2,(H,17,18) |
| InChIKey | OTJVDWRNCVKREQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|