C10H9ClF3NO3 — CID 117455861
2-amino-3-[2-chloro-6-hydroxy-4-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 117455861) has the molecular formula C10H9ClF3NO3 and a molecular weight of 283.63 g/mol. Its IUPAC name is 2-amino-3-[2-chloro-6-hydroxy-4-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[2-chloro-6-hydroxy-4-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 117455861 |
| Molecular Formula | C10H9ClF3NO3 |
| Molecular Weight | 283.63 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-amino-3-[2-chloro-6-hydroxy-4-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | NC(Cc1c(O)cc(C(F)(F)F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C10H9ClF3NO3/c11-6-1-4(10(12,13)14)2-8(16)5(6)3-7(15)9(17)18/h1-2,7,16H,3,15H2,(H,17,18) |
| InChIKey | JFOQMVVFXKSACL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.63 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |