C10H10ClF3N2O2 — CID 68590975
(2R)-2-amino-3-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 68590975) has the molecular formula C10H10ClF3N2O2 and a molecular weight of 282.65 g/mol. Its IUPAC name is (2R)-2-amino-3-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 68590975 |
| Molecular Formula | C10H10ClF3N2O2 |
| Molecular Weight | 282.65 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | (2R)-2-amino-3-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | Nc1c(Cl)cc(C[C@@H](N)C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C10H10ClF3N2O2/c11-6-2-4(3-7(15)9(17)18)1-5(8(6)16)10(12,13)14/h1-2,7H,3,15-16H2,(H,17,18)/t7-/m1/s1 |
| InChIKey | UZRUTCSJMPXRDM-SSDOTTSWSA-N |
| XLogP | 1.90 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.65 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|