C10H5Cl3F3N — CID 2781606
2-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]propanenitrile (PubChem CID 2781606) has the molecular formula C10H5Cl3F3N and a molecular weight of 302.51 g/mol. Its IUPAC name is 2-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]propanenitrile.
| Compound Name | 2-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]propanenitrile |
|---|---|
| PubChem CID | 2781606 |
| Molecular Formula | C10H5Cl3F3N |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 300.94 |
| IUPAC Name | 2-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]propanenitrile |
| SMILES | N#CC(Cl)Cc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H5Cl3F3N/c11-6(4-17)3-7-8(12)1-5(2-9(7)13)10(14,15)16/h1-2,6H,3H2 |
| InChIKey | SNWKIBZOADQKKI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|