C7H5BCl2F3- — CID 172878584
[2,6-dichloro-4-(trifluoromethyl)phenyl]boranuide (PubChem CID 172878584) has the molecular formula C7H5BCl2F3- and a molecular weight of 227.83 g/mol. Its IUPAC name is [2,6-dichloro-4-(trifluoromethyl)phenyl]boranuide.
| Compound Name | [2,6-dichloro-4-(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 172878584 |
| Molecular Formula | C7H5BCl2F3- |
| Molecular Weight | 227.83 g/mol |
| Exact Mass | 226.98 |
| IUPAC Name | [2,6-dichloro-4-(trifluoromethyl)phenyl]boranuide |
| SMILES | [BH3-]c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C7H5BCl2F3/c8-6-4(9)1-3(2-5(6)10)7(11,12)13/h1-2H,8H3/q-1 |
| InChIKey | CXWSOZNPCSOLRY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.83 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|