C14H4Cl3F9 — CID 157268578
1,2,3-trichloro-5-(trifluoromethyl)benzene;1,2,3-trifluoro-5-(trifluoromethyl)benzene (PubChem CID 157268578) has the molecular formula C14H4Cl3F9 and a molecular weight of 449.53 g/mol. Its IUPAC name is 1,2,3-trichloro-5-(trifluoromethyl)benzene;1,2,3-trifluoro-5-(trifluoromethyl)benzene.
| Compound Name | 1,2,3-trichloro-5-(trifluoromethyl)benzene;1,2,3-trifluoro-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 157268578 |
| Molecular Formula | C14H4Cl3F9 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 447.92 |
| IUPAC Name | 1,2,3-trichloro-5-(trifluoromethyl)benzene;1,2,3-trifluoro-5-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cc(Cl)c(Cl)c(Cl)c1.Fc1cc(C(F)(F)F)cc(F)c1F |
| InChI | InChI=1S/C7H2Cl3F3.C7H2F6/c2*8-4-1-3(7(11,12)13)2-5(9)6(4)10/h2*1-2H |
| InChIKey | AYGSTZZNFMIVGP-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|