C8H7Cl2F3N2 — CID 142056538
1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methylhydrazine (PubChem CID 142056538) has the molecular formula C8H7Cl2F3N2 and a molecular weight of 259.06 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methylhydrazine.
| Compound Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methylhydrazine |
|---|---|
| PubChem CID | 142056538 |
| Molecular Formula | C8H7Cl2F3N2 |
| Molecular Weight | 259.06 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-2-methylhydrazine |
| SMILES | CNNc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C8H7Cl2F3N2/c1-14-15-7-5(9)2-4(3-6(7)10)8(11,12)13/h2-3,14-15H,1H3 |
| InChIKey | AYFYRIHKUAAAMP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.06 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|