C12H12Cl2F3N — CID 170496555
4-[2,6-dichloro-4-(trifluoromethyl)phenyl]-N-methylbut-3-en-1-amine (PubChem CID 170496555) has the molecular formula C12H12Cl2F3N and a molecular weight of 298.14 g/mol. Its IUPAC name is 4-[2,6-dichloro-4-(trifluoromethyl)phenyl]-N-methylbut-3-en-1-amine.
| Compound Name | 4-[2,6-dichloro-4-(trifluoromethyl)phenyl]-N-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 170496555 |
| Molecular Formula | C12H12Cl2F3N |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 4-[2,6-dichloro-4-(trifluoromethyl)phenyl]-N-methylbut-3-en-1-amine |
| SMILES | CNCCC=Cc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H12Cl2F3N/c1-18-5-3-2-4-9-10(13)6-8(7-11(9)14)12(15,16)17/h2,4,6-7,18H,3,5H2,1H3 |
| InChIKey | UCIOUJUBNQRFIB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|