C12H13ClF3N — CID 170496242
4-[3-chloro-5-(trifluoromethyl)phenyl]-N-methylbut-3-en-1-amine (PubChem CID 170496242) has the molecular formula C12H13ClF3N and a molecular weight of 263.69 g/mol. Its IUPAC name is 4-[3-chloro-5-(trifluoromethyl)phenyl]-N-methylbut-3-en-1-amine.
| Compound Name | 4-[3-chloro-5-(trifluoromethyl)phenyl]-N-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 170496242 |
| Molecular Formula | C12H13ClF3N |
| Molecular Weight | 263.69 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 4-[3-chloro-5-(trifluoromethyl)phenyl]-N-methylbut-3-en-1-amine |
| SMILES | CNCCC=Cc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13ClF3N/c1-17-5-3-2-4-9-6-10(12(14,15)16)8-11(13)7-9/h2,4,6-8,17H,3,5H2,1H3 |
| InChIKey | WWIVMXPSXLJMKR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.69 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|