C11H10ClF3O — CID 170477050
4-[3-chloro-5-(trifluoromethyl)phenyl]but-3-en-1-ol (PubChem CID 170477050) has the molecular formula C11H10ClF3O and a molecular weight of 250.65 g/mol. Its IUPAC name is 4-[3-chloro-5-(trifluoromethyl)phenyl]but-3-en-1-ol.
| Compound Name | 4-[3-chloro-5-(trifluoromethyl)phenyl]but-3-en-1-ol |
|---|---|
| PubChem CID | 170477050 |
| Molecular Formula | C11H10ClF3O |
| Molecular Weight | 250.65 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 4-[3-chloro-5-(trifluoromethyl)phenyl]but-3-en-1-ol |
| SMILES | OCCC=Cc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10ClF3O/c12-10-6-8(3-1-2-4-16)5-9(7-10)11(13,14)15/h1,3,5-7,16H,2,4H2 |
| InChIKey | UZQDTZZHODREAD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.65 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |