C12H10F6O — CID 118168632
(Z)-4-[3,5-bis(trifluoromethyl)phenyl]but-3-en-1-ol (PubChem CID 118168632) has the molecular formula C12H10F6O and a molecular weight of 284.20 g/mol. Its IUPAC name is (Z)-4-[3,5-bis(trifluoromethyl)phenyl]but-3-en-1-ol.
| Compound Name | (Z)-4-[3,5-bis(trifluoromethyl)phenyl]but-3-en-1-ol |
|---|---|
| PubChem CID | 118168632 |
| Molecular Formula | C12H10F6O |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | (Z)-4-[3,5-bis(trifluoromethyl)phenyl]but-3-en-1-ol |
| SMILES | OCC/C=C\c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F6O/c13-11(14,15)9-5-8(3-1-2-4-19)6-10(7-9)12(16,17)18/h1,3,5-7,19H,2,4H2/b3-1- |
| InChIKey | CAPQPGIXGKNXCP-IWQZZHSRSA-N |
| XLogP | 4.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |