C12H10ClF3O2 — CID 170500039
3-(4-chlorobut-1-enyl)-5-(trifluoromethyl)benzoic acid (PubChem CID 170500039) has the molecular formula C12H10ClF3O2 and a molecular weight of 278.66 g/mol. Its IUPAC name is 3-(4-chlorobut-1-enyl)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 3-(4-chlorobut-1-enyl)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 170500039 |
| Molecular Formula | C12H10ClF3O2 |
| Molecular Weight | 278.66 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 3-(4-chlorobut-1-enyl)-5-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1cc(C=CCCCl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10ClF3O2/c13-4-2-1-3-8-5-9(11(17)18)7-10(6-8)12(14,15)16/h1,3,5-7H,2,4H2,(H,17,18) |
| InChIKey | WFVKKUMVGGPCLU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.66 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|