C13H12F3NO3 — CID 169466368
3-(3-acetamidoprop-1-enyl)-5-(trifluoromethyl)benzoic acid (PubChem CID 169466368) has the molecular formula C13H12F3NO3 and a molecular weight of 287.24 g/mol. Its IUPAC name is 3-(3-acetamidoprop-1-enyl)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 3-(3-acetamidoprop-1-enyl)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 169466368 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3-(3-acetamidoprop-1-enyl)-5-(trifluoromethyl)benzoic acid |
| SMILES | CC(=O)NCC=Cc1cc(C(=O)O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F3NO3/c1-8(18)17-4-2-3-9-5-10(12(19)20)7-11(6-9)13(14,15)16/h2-3,5-7H,4H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | JIBNJQVRFNYDQX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |