C13H11F3O4 — CID 170501796
3-(4-methoxy-4-oxobut-1-enyl)-5-(trifluoromethyl)benzoic acid (PubChem CID 170501796) has the molecular formula C13H11F3O4 and a molecular weight of 288.22 g/mol. Its IUPAC name is 3-(4-methoxy-4-oxobut-1-enyl)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 3-(4-methoxy-4-oxobut-1-enyl)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 170501796 |
| Molecular Formula | C13H11F3O4 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 3-(4-methoxy-4-oxobut-1-enyl)-5-(trifluoromethyl)benzoic acid |
| SMILES | COC(=O)CC=Cc1cc(C(=O)O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11F3O4/c1-20-11(17)4-2-3-8-5-9(12(18)19)7-10(6-8)13(14,15)16/h2-3,5-7H,4H2,1H3,(H,18,19) |
| InChIKey | VRJRJWABPLDOBI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |