About methyl 4-(3,4,5-trichlorophenyl)but-3-enoate
methyl 4-(3,4,5-trichlorophenyl)but-3-enoate (PubChem CID 170500693) has the molecular formula C11H9Cl3O2
and a molecular weight of 279.55 g/mol. Its IUPAC name is methyl 4-(3,4,5-trichlorophenyl)but-3-enoate.
Molecular Properties
| Compound Name | methyl 4-(3,4,5-trichlorophenyl)but-3-enoate |
| PubChem CID | 170500693 |
| Molecular Formula | C11H9Cl3O2 |
| Molecular Weight | 279.55 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | methyl 4-(3,4,5-trichlorophenyl)but-3-enoate |
| SMILES | COC(=O)CC=Cc1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl3O2/c1-16-10(15)4-2-3-7-5-8(12)11(14)9(13)6-7/h2-3,5-6H,4H2,1H3 |
| InChIKey | XMKPHGJYXMPZCS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(3,4,5-trichlorophenyl)but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(3,4,5-trichlorophenyl)but-3-enoate?
The IUPAC name of methyl 4-(3,4,5-trichlorophenyl)but-3-enoate (CID 170500693) is methyl 4-(3,4,5-trichlorophenyl)but-3-enoate.
What is the SMILES notation for methyl 4-(3,4,5-trichlorophenyl)but-3-enoate?
The canonical SMILES for methyl 4-(3,4,5-trichlorophenyl)but-3-enoate is COC(=O)CC=Cc1cc(Cl)c(Cl)c(Cl)c1.
What is the InChIKey of methyl 4-(3,4,5-trichlorophenyl)but-3-enoate?
The InChIKey is XMKPHGJYXMPZCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl3O2/c1-16-10(15)4-2-3-7-5-8(12)11(14)9(13)6-7/h2-3,5-6H,4H2,1H3.
What are the key properties of methyl 4-(3,4,5-trichlorophenyl)but-3-enoate?
methyl 4-(3,4,5-trichlorophenyl)but-3-enoate has a molecular weight of 279.55 g/mol, XLogP of 4.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3,4,5-trichlorophenyl)but-3-enoate is sourced from PubChem (CID 170500693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).