C19H17ClF3NO2 — CID 170494545
benzyl N-[4-[3-chloro-5-(trifluoromethyl)phenyl]but-3-enyl]carbamate (PubChem CID 170494545) has the molecular formula C19H17ClF3NO2 and a molecular weight of 383.80 g/mol. Its IUPAC name is benzyl N-[4-[3-chloro-5-(trifluoromethyl)phenyl]but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-[3-chloro-5-(trifluoromethyl)phenyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170494545 |
| Molecular Formula | C19H17ClF3NO2 |
| Molecular Weight | 383.80 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | benzyl N-[4-[3-chloro-5-(trifluoromethyl)phenyl]but-3-enyl]carbamate |
| SMILES | O=C(NCCC=Cc1cc(Cl)cc(C(F)(F)F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C19H17ClF3NO2/c20-17-11-15(10-16(12-17)19(21,22)23)8-4-5-9-24-18(25)26-13-14-6-2-1-3-7-14/h1-4,6-8,10-12H,5,9,13H2,(H,24,25) |
| InChIKey | KXLCBUVKYWXXJW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.80 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|