C19H17F3N2O4 — CID 170494981
benzyl N-[4-[3-nitro-5-(trifluoromethyl)phenyl]but-3-enyl]carbamate (PubChem CID 170494981) has the molecular formula C19H17F3N2O4 and a molecular weight of 394.35 g/mol. Its IUPAC name is benzyl N-[4-[3-nitro-5-(trifluoromethyl)phenyl]but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-[3-nitro-5-(trifluoromethyl)phenyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170494981 |
| Molecular Formula | C19H17F3N2O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | benzyl N-[4-[3-nitro-5-(trifluoromethyl)phenyl]but-3-enyl]carbamate |
| SMILES | O=C(NCCC=Cc1cc([N+](=O)[O-])cc(C(F)(F)F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C19H17F3N2O4/c20-19(21,22)16-10-15(11-17(12-16)24(26)27)8-4-5-9-23-18(25)28-13-14-6-2-1-3-7-14/h1-4,6-8,10-12H,5,9,13H2,(H,23,25) |
| InChIKey | MFLGQDYBGIXAEA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|