C21H22N2O6 — CID 170495022
methyl 2-methyl-3-nitro-5-[4-(phenylmethoxycarbonylamino)but-1-enyl]benzoate (PubChem CID 170495022) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is methyl 2-methyl-3-nitro-5-[4-(phenylmethoxycarbonylamino)but-1-enyl]benzoate.
| Compound Name | methyl 2-methyl-3-nitro-5-[4-(phenylmethoxycarbonylamino)but-1-enyl]benzoate |
|---|---|
| PubChem CID | 170495022 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | methyl 2-methyl-3-nitro-5-[4-(phenylmethoxycarbonylamino)but-1-enyl]benzoate |
| SMILES | COC(=O)c1cc(C=CCCNC(=O)OCc2ccccc2)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C21H22N2O6/c1-15-18(20(24)28-2)12-17(13-19(15)23(26)27)10-6-7-11-22-21(25)29-14-16-8-4-3-5-9-16/h3-6,8-10,12-13H,7,11,14H2,1-2H3,(H,22,25) |
| InChIKey | MJCWHVDCIOECIT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|