C13H15NO5 — CID 170477519
methyl 5-(4-hydroxybut-1-enyl)-2-methyl-3-nitrobenzoate (PubChem CID 170477519) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is methyl 5-(4-hydroxybut-1-enyl)-2-methyl-3-nitrobenzoate.
| Compound Name | methyl 5-(4-hydroxybut-1-enyl)-2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 170477519 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | methyl 5-(4-hydroxybut-1-enyl)-2-methyl-3-nitrobenzoate |
| SMILES | COC(=O)c1cc(C=CCCO)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C13H15NO5/c1-9-11(13(16)19-2)7-10(5-3-4-6-15)8-12(9)14(17)18/h3,5,7-8,15H,4,6H2,1-2H3 |
| InChIKey | OVFWIFDXLAASDB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|