C12H13NO4S — CID 170479257
2-methyl-3-nitro-5-(4-sulfanylbut-1-enyl)benzoic acid (PubChem CID 170479257) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-methyl-3-nitro-5-(4-sulfanylbut-1-enyl)benzoic acid.
| Compound Name | 2-methyl-3-nitro-5-(4-sulfanylbut-1-enyl)benzoic acid |
|---|---|
| PubChem CID | 170479257 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-methyl-3-nitro-5-(4-sulfanylbut-1-enyl)benzoic acid |
| SMILES | Cc1c(C(=O)O)cc(C=CCCS)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13NO4S/c1-8-10(12(14)15)6-9(4-2-3-5-18)7-11(8)13(16)17/h2,4,6-7,18H,3,5H2,1H3,(H,14,15) |
| InChIKey | GVQRXBMWGVRTCH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|