C11H10BrNO4 — CID 169476355
5-(3-bromoprop-1-enyl)-2-methyl-3-nitrobenzoic acid (PubChem CID 169476355) has the molecular formula C11H10BrNO4 and a molecular weight of 300.11 g/mol. Its IUPAC name is 5-(3-bromoprop-1-enyl)-2-methyl-3-nitrobenzoic acid.
| Compound Name | 5-(3-bromoprop-1-enyl)-2-methyl-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 169476355 |
| Molecular Formula | C11H10BrNO4 |
| Molecular Weight | 300.11 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 5-(3-bromoprop-1-enyl)-2-methyl-3-nitrobenzoic acid |
| SMILES | Cc1c(C(=O)O)cc(C=CCBr)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10BrNO4/c1-7-9(11(14)15)5-8(3-2-4-12)6-10(7)13(16)17/h2-3,5-6H,4H2,1H3,(H,14,15) |
| InChIKey | TTYVTPGVOYIUQG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.11 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|