C19H18N2O6 — CID 169472546
2-methyl-3-nitro-5-[3-(phenylmethoxycarbonylamino)prop-1-enyl]benzoic acid (PubChem CID 169472546) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is 2-methyl-3-nitro-5-[3-(phenylmethoxycarbonylamino)prop-1-enyl]benzoic acid.
| Compound Name | 2-methyl-3-nitro-5-[3-(phenylmethoxycarbonylamino)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 169472546 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-methyl-3-nitro-5-[3-(phenylmethoxycarbonylamino)prop-1-enyl]benzoic acid |
| SMILES | Cc1c(C(=O)O)cc(C=CCNC(=O)OCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18N2O6/c1-13-16(18(22)23)10-15(11-17(13)21(25)26)8-5-9-20-19(24)27-12-14-6-3-2-4-7-14/h2-8,10-11H,9,12H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | UYIPXSJXLSMOFG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|