C20H18N2O6 — CID 170463477
2-methyl-3-nitro-5-[4-(phenylmethoxycarbonylamino)but-1-ynyl]benzoic acid (PubChem CID 170463477) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is 2-methyl-3-nitro-5-[4-(phenylmethoxycarbonylamino)but-1-ynyl]benzoic acid.
| Compound Name | 2-methyl-3-nitro-5-[4-(phenylmethoxycarbonylamino)but-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 170463477 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-methyl-3-nitro-5-[4-(phenylmethoxycarbonylamino)but-1-ynyl]benzoic acid |
| SMILES | Cc1c(C(=O)O)cc(C#CCCNC(=O)OCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18N2O6/c1-14-17(19(23)24)11-16(12-18(14)22(26)27)9-5-6-10-21-20(25)28-13-15-7-3-2-4-8-15/h2-4,7-8,11-12H,6,10,13H2,1H3,(H,21,25)(H,23,24) |
| InChIKey | LYPXSJOLKAFPDK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|