C17H14ClN3O4 — CID 170462887
benzyl N-[4-(6-chloro-5-nitro-3-pyridinyl)but-3-ynyl]carbamate (PubChem CID 170462887) has the molecular formula C17H14ClN3O4 and a molecular weight of 359.77 g/mol. Its IUPAC name is benzyl N-[4-(6-chloro-5-nitro-3-pyridinyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(6-chloro-5-nitro-3-pyridinyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462887 |
| Molecular Formula | C17H14ClN3O4 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | benzyl N-[4-(6-chloro-5-nitro-3-pyridinyl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cnc(Cl)c([N+](=O)[O-])c1)OCc1ccccc1 |
| InChI | InChI=1S/C17H14ClN3O4/c18-16-15(21(23)24)10-14(11-20-16)8-4-5-9-19-17(22)25-12-13-6-2-1-3-7-13/h1-3,6-7,10-11H,5,9,12H2,(H,19,22) |
| InChIKey | QILMVQPBIVAGBD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|