C18H17ClN2O2 — CID 170462217
benzyl N-[4-(6-chloro-5-methyl-3-pyridinyl)but-3-ynyl]carbamate (PubChem CID 170462217) has the molecular formula C18H17ClN2O2 and a molecular weight of 328.80 g/mol. Its IUPAC name is benzyl N-[4-(6-chloro-5-methyl-3-pyridinyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(6-chloro-5-methyl-3-pyridinyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462217 |
| Molecular Formula | C18H17ClN2O2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | benzyl N-[4-(6-chloro-5-methyl-3-pyridinyl)but-3-ynyl]carbamate |
| SMILES | Cc1cc(C#CCCNC(=O)OCc2ccccc2)cnc1Cl |
| InChI | InChI=1S/C18H17ClN2O2/c1-14-11-16(12-21-17(14)19)9-5-6-10-20-18(22)23-13-15-7-3-2-4-8-15/h2-4,7-8,11-12H,6,10,13H2,1H3,(H,20,22) |
| InChIKey | UBSKAHNWGCTXSI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|