C20H20N2O4 — CID 170463191
ethyl 5-[4-(phenylmethoxycarbonylamino)but-1-ynyl]pyridine-3-carboxylate (PubChem CID 170463191) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is ethyl 5-[4-(phenylmethoxycarbonylamino)but-1-ynyl]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[4-(phenylmethoxycarbonylamino)but-1-ynyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 170463191 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | ethyl 5-[4-(phenylmethoxycarbonylamino)but-1-ynyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cncc(C#CCCNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C20H20N2O4/c1-2-25-19(23)18-12-17(13-21-14-18)10-6-7-11-22-20(24)26-15-16-8-4-3-5-9-16/h3-5,8-9,12-14H,2,7,11,15H2,1H3,(H,22,24) |
| InChIKey | YUOIKXYYQJGNCC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|