C16H17N3O2 — CID 170461917
benzyl N-[4-(5-methyl-1H-pyrazol-4-yl)but-3-ynyl]carbamate (PubChem CID 170461917) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is benzyl N-[4-(5-methyl-1H-pyrazol-4-yl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(5-methyl-1H-pyrazol-4-yl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170461917 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | benzyl N-[4-(5-methyl-1H-pyrazol-4-yl)but-3-ynyl]carbamate |
| SMILES | Cc1[nH]ncc1C#CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H17N3O2/c1-13-15(11-18-19-13)9-5-6-10-17-16(20)21-12-14-7-3-2-4-8-14/h2-4,7-8,11H,6,10,12H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | LEQFYFOIJMXWMV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|