C17H15ClN2O2 — CID 170461993
benzyl N-[4-(4-chloro-3-pyridinyl)but-3-ynyl]carbamate (PubChem CID 170461993) has the molecular formula C17H15ClN2O2 and a molecular weight of 314.77 g/mol. Its IUPAC name is benzyl N-[4-(4-chloro-3-pyridinyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(4-chloro-3-pyridinyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170461993 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | benzyl N-[4-(4-chloro-3-pyridinyl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cnccc1Cl)OCc1ccccc1 |
| InChI | InChI=1S/C17H15ClN2O2/c18-16-9-11-19-12-15(16)8-4-5-10-20-17(21)22-13-14-6-2-1-3-7-14/h1-3,6-7,9,11-12H,5,10,13H2,(H,20,21) |
| InChIKey | DXPRPTJOABKHFW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|