C18H15ClN2O4 — CID 170462941
6-chloro-3-[4-(phenylmethoxycarbonylamino)but-1-ynyl]pyridine-2-carboxylic acid (PubChem CID 170462941) has the molecular formula C18H15ClN2O4 and a molecular weight of 358.78 g/mol. Its IUPAC name is 6-chloro-3-[4-(phenylmethoxycarbonylamino)but-1-ynyl]pyridine-2-carboxylic acid.
| Compound Name | 6-chloro-3-[4-(phenylmethoxycarbonylamino)but-1-ynyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 170462941 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 6-chloro-3-[4-(phenylmethoxycarbonylamino)but-1-ynyl]pyridine-2-carboxylic acid |
| SMILES | O=C(NCCC#Cc1ccc(Cl)nc1C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C18H15ClN2O4/c19-15-10-9-14(16(21-15)17(22)23)8-4-5-11-20-18(24)25-12-13-6-2-1-3-7-13/h1-3,6-7,9-10H,5,11-12H2,(H,20,24)(H,22,23) |
| InChIKey | AIENUBANVXSASA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|