C18H15ClN2O4 — CID 170462961
benzyl N-[4-(4-chloro-2-nitrophenyl)but-3-ynyl]carbamate (PubChem CID 170462961) has the molecular formula C18H15ClN2O4 and a molecular weight of 358.78 g/mol. Its IUPAC name is benzyl N-[4-(4-chloro-2-nitrophenyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(4-chloro-2-nitrophenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462961 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | benzyl N-[4-(4-chloro-2-nitrophenyl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1ccc(Cl)cc1[N+](=O)[O-])OCc1ccccc1 |
| InChI | InChI=1S/C18H15ClN2O4/c19-16-10-9-15(17(12-16)21(23)24)8-4-5-11-20-18(22)25-13-14-6-2-1-3-7-14/h1-3,6-7,9-10,12H,5,11,13H2,(H,20,22) |
| InChIKey | NSMKNSHODKUOPA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|