C18H16FNO3 — CID 170462112
benzyl N-[4-(2-fluoro-5-hydroxyphenyl)but-3-ynyl]carbamate (PubChem CID 170462112) has the molecular formula C18H16FNO3 and a molecular weight of 313.33 g/mol. Its IUPAC name is benzyl N-[4-(2-fluoro-5-hydroxyphenyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(2-fluoro-5-hydroxyphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462112 |
| Molecular Formula | C18H16FNO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | benzyl N-[4-(2-fluoro-5-hydroxyphenyl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cc(O)ccc1F)OCc1ccccc1 |
| InChI | InChI=1S/C18H16FNO3/c19-17-10-9-16(21)12-15(17)8-4-5-11-20-18(22)23-13-14-6-2-1-3-7-14/h1-3,6-7,9-10,12,21H,5,11,13H2,(H,20,22) |
| InChIKey | FFURTRDOXYDFJX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|