C19H16F3NO4 — CID 170463370
benzyl N-[4-[5-hydroxy-2-(trifluoromethoxy)phenyl]but-3-ynyl]carbamate (PubChem CID 170463370) has the molecular formula C19H16F3NO4 and a molecular weight of 379.33 g/mol. Its IUPAC name is benzyl N-[4-[5-hydroxy-2-(trifluoromethoxy)phenyl]but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-[5-hydroxy-2-(trifluoromethoxy)phenyl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170463370 |
| Molecular Formula | C19H16F3NO4 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | benzyl N-[4-[5-hydroxy-2-(trifluoromethoxy)phenyl]but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cc(O)ccc1OC(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C19H16F3NO4/c20-19(21,22)27-17-10-9-16(24)12-15(17)8-4-5-11-23-18(25)26-13-14-6-2-1-3-7-14/h1-3,6-7,9-10,12,24H,5,11,13H2,(H,23,25) |
| InChIKey | FQJCRJLPDXGQBP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|