C19H17F3N2O2 — CID 170463172
benzyl N-[4-[3-amino-5-(trifluoromethyl)phenyl]but-3-ynyl]carbamate (PubChem CID 170463172) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is benzyl N-[4-[3-amino-5-(trifluoromethyl)phenyl]but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-[3-amino-5-(trifluoromethyl)phenyl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170463172 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | benzyl N-[4-[3-amino-5-(trifluoromethyl)phenyl]but-3-ynyl]carbamate |
| SMILES | Nc1cc(C#CCCNC(=O)OCc2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F3N2O2/c20-19(21,22)16-10-15(11-17(23)12-16)8-4-5-9-24-18(25)26-13-14-6-2-1-3-7-14/h1-3,6-7,10-12H,5,9,13,23H2,(H,24,25) |
| InChIKey | HGJDUYNVSJFEIO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|