C19H15ClF3NO2 — CID 170463035
benzyl N-[4-[4-chloro-3-(trifluoromethyl)phenyl]but-3-ynyl]carbamate (PubChem CID 170463035) has the molecular formula C19H15ClF3NO2 and a molecular weight of 381.78 g/mol. Its IUPAC name is benzyl N-[4-[4-chloro-3-(trifluoromethyl)phenyl]but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-[4-chloro-3-(trifluoromethyl)phenyl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170463035 |
| Molecular Formula | C19H15ClF3NO2 |
| Molecular Weight | 381.78 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | benzyl N-[4-[4-chloro-3-(trifluoromethyl)phenyl]but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1ccc(Cl)c(C(F)(F)F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C19H15ClF3NO2/c20-17-10-9-14(12-16(17)19(21,22)23)6-4-5-11-24-18(25)26-13-15-7-2-1-3-8-15/h1-3,7-10,12H,5,11,13H2,(H,24,25) |
| InChIKey | AFMYBJWGHDPWOT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.78 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|