C19H15F4NO2 — CID 170463044
benzyl N-[4-[2-fluoro-3-(trifluoromethyl)phenyl]but-3-ynyl]carbamate (PubChem CID 170463044) has the molecular formula C19H15F4NO2 and a molecular weight of 365.33 g/mol. Its IUPAC name is benzyl N-[4-[2-fluoro-3-(trifluoromethyl)phenyl]but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-[2-fluoro-3-(trifluoromethyl)phenyl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170463044 |
| Molecular Formula | C19H15F4NO2 |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | benzyl N-[4-[2-fluoro-3-(trifluoromethyl)phenyl]but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cccc(C(F)(F)F)c1F)OCc1ccccc1 |
| InChI | InChI=1S/C19H15F4NO2/c20-17-15(10-6-11-16(17)19(21,22)23)9-4-5-12-24-18(25)26-13-14-7-2-1-3-8-14/h1-3,6-8,10-11H,5,12-13H2,(H,24,25) |
| InChIKey | RCMMIBORDBJOIX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|