C20H22N2O2 — CID 170462576
benzyl N-[4-[2-(2-aminoethyl)phenyl]but-3-ynyl]carbamate (PubChem CID 170462576) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is benzyl N-[4-[2-(2-aminoethyl)phenyl]but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-[2-(2-aminoethyl)phenyl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462576 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | benzyl N-[4-[2-(2-aminoethyl)phenyl]but-3-ynyl]carbamate |
| SMILES | NCCc1ccccc1C#CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H22N2O2/c21-14-13-19-11-5-4-10-18(19)12-6-7-15-22-20(23)24-16-17-8-2-1-3-9-17/h1-5,8-11H,7,13-16,21H2,(H,22,23) |
| InChIKey | VBHNVVJSLJDLAK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|