C19H17NO4 — CID 170462386
benzyl N-[4-(3-formyl-2-hydroxyphenyl)but-3-ynyl]carbamate (PubChem CID 170462386) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is benzyl N-[4-(3-formyl-2-hydroxyphenyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(3-formyl-2-hydroxyphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462386 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | benzyl N-[4-(3-formyl-2-hydroxyphenyl)but-3-ynyl]carbamate |
| SMILES | O=Cc1cccc(C#CCCNC(=O)OCc2ccccc2)c1O |
| InChI | InChI=1S/C19H17NO4/c21-13-17-11-6-10-16(18(17)22)9-4-5-12-20-19(23)24-14-15-7-2-1-3-8-15/h1-3,6-8,10-11,13,22H,5,12,14H2,(H,20,23) |
| InChIKey | MZNPGSFGFPDWBJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|