C20H19NO5 — CID 170463119
benzyl N-[4-(6-formyl-2-hydroxy-3-methoxyphenyl)but-3-ynyl]carbamate (PubChem CID 170463119) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is benzyl N-[4-(6-formyl-2-hydroxy-3-methoxyphenyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(6-formyl-2-hydroxy-3-methoxyphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170463119 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | benzyl N-[4-(6-formyl-2-hydroxy-3-methoxyphenyl)but-3-ynyl]carbamate |
| SMILES | COc1ccc(C=O)c(C#CCCNC(=O)OCc2ccccc2)c1O |
| InChI | InChI=1S/C20H19NO5/c1-25-18-11-10-16(13-22)17(19(18)23)9-5-6-12-21-20(24)26-14-15-7-3-2-4-8-15/h2-4,7-8,10-11,13,23H,6,12,14H2,1H3,(H,21,24) |
| InChIKey | ONYGJYRLIABUAJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|