C21H18N2O3 — CID 170463312
benzyl N-[4-(3-formyl-1H-indol-6-yl)but-3-ynyl]carbamate (PubChem CID 170463312) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is benzyl N-[4-(3-formyl-1H-indol-6-yl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(3-formyl-1H-indol-6-yl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170463312 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | benzyl N-[4-(3-formyl-1H-indol-6-yl)but-3-ynyl]carbamate |
| SMILES | O=Cc1c[nH]c2cc(C#CCCNC(=O)OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C21H18N2O3/c24-14-18-13-23-20-12-16(9-10-19(18)20)6-4-5-11-22-21(25)26-15-17-7-2-1-3-8-17/h1-3,7-10,12-14,23H,5,11,15H2,(H,22,25) |
| InChIKey | WLJGBKRYLSKHGE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|