C20H19NO4 — CID 170462709
benzyl N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-ynyl]carbamate (PubChem CID 170462709) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is benzyl N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462709 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | benzyl N-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1ccc2c(c1)OCCO2)OCc1ccccc1 |
| InChI | InChI=1S/C20H19NO4/c22-20(25-15-17-7-2-1-3-8-17)21-11-5-4-6-16-9-10-18-19(14-16)24-13-12-23-18/h1-3,7-10,14H,5,11-13,15H2,(H,21,22) |
| InChIKey | VOAMCPPNDXCEGG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|