C18H18N2O2 — CID 170462011
benzyl N-[4-(2-methyl-4-pyridinyl)but-3-ynyl]carbamate (PubChem CID 170462011) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is benzyl N-[4-(2-methyl-4-pyridinyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(2-methyl-4-pyridinyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462011 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | benzyl N-[4-(2-methyl-4-pyridinyl)but-3-ynyl]carbamate |
| SMILES | Cc1cc(C#CCCNC(=O)OCc2ccccc2)ccn1 |
| InChI | InChI=1S/C18H18N2O2/c1-15-13-16(10-12-19-15)7-5-6-11-20-18(21)22-14-17-8-3-2-4-9-17/h2-4,8-10,12-13H,6,11,14H2,1H3,(H,20,21) |
| InChIKey | AMOXCYOCGCAKSB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|