C23H23N3O2 — CID 170463492
benzyl N-[4-[3-(3,5-dimethylpyrazol-1-yl)phenyl]but-3-ynyl]carbamate (PubChem CID 170463492) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is benzyl N-[4-[3-(3,5-dimethylpyrazol-1-yl)phenyl]but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-[3-(3,5-dimethylpyrazol-1-yl)phenyl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170463492 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | benzyl N-[4-[3-(3,5-dimethylpyrazol-1-yl)phenyl]but-3-ynyl]carbamate |
| SMILES | Cc1cc(C)n(-c2cccc(C#CCCNC(=O)OCc3ccccc3)c2)n1 |
| InChI | InChI=1S/C23H23N3O2/c1-18-15-19(2)26(25-18)22-13-8-12-20(16-22)9-6-7-14-24-23(27)28-17-21-10-4-3-5-11-21/h3-5,8,10-13,15-16H,7,14,17H2,1-2H3,(H,24,27) |
| InChIKey | XHBRKGYAGIQETK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|