C16H16N2O2 — CID 170470424
methyl 4-[3-(3,5-dimethylpyrazol-1-yl)phenyl]but-3-ynoate (PubChem CID 170470424) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is methyl 4-[3-(3,5-dimethylpyrazol-1-yl)phenyl]but-3-ynoate.
| Compound Name | methyl 4-[3-(3,5-dimethylpyrazol-1-yl)phenyl]but-3-ynoate |
|---|---|
| PubChem CID | 170470424 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | methyl 4-[3-(3,5-dimethylpyrazol-1-yl)phenyl]but-3-ynoate |
| SMILES | COC(=O)CC#Cc1cccc(-n2nc(C)cc2C)c1 |
| InChI | InChI=1S/C16H16N2O2/c1-12-10-13(2)18(17-12)15-8-4-6-14(11-15)7-5-9-16(19)20-3/h4,6,8,10-11H,9H2,1-3H3 |
| InChIKey | MTBPSXLCBAPKGJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|