C15H20N2O2 — CID 144722920
2-[3-(3,5-dimethylpyrazol-1-yl)phenyl]acetic acid;ethane (PubChem CID 144722920) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylpyrazol-1-yl)phenyl]acetic acid;ethane.
| Compound Name | 2-[3-(3,5-dimethylpyrazol-1-yl)phenyl]acetic acid;ethane |
|---|---|
| PubChem CID | 144722920 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-[3-(3,5-dimethylpyrazol-1-yl)phenyl]acetic acid;ethane |
| SMILES | CC.Cc1cc(C)n(-c2cccc(CC(=O)O)c2)n1 |
| InChI | InChI=1S/C13H14N2O2.C2H6/c1-9-6-10(2)15(14-9)12-5-3-4-11(7-12)8-13(16)17;1-2/h3-7H,8H2,1-2H3,(H,16,17);1-2H3 |
| InChIKey | VFRWEGNUZMESJT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |