C13H14N3O — CID 58656859
CID 58656859 (PubChem CID 58656859) has the molecular formula C13H14N3O and a molecular weight of 228.27 g/mol.
| Compound Name | CID 58656859 |
|---|---|
| PubChem CID | 58656859 |
| Molecular Formula | C13H14N3O |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | — |
| SMILES | [CH2]NC(=O)c1cccc(-n2nc(C)cc2C)c1 |
| InChI | InChI=1S/C13H14N3O/c1-9-7-10(2)16(15-9)12-6-4-5-11(8-12)13(17)14-3/h4-8H,3H2,1-2H3,(H,14,17) |
| InChIKey | OGFPFEFXECPIPD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |